| Product Name | 2,4-Dichloro-6-iodoaniline |
| CAS No. | 697-90-5 |
| InChI | InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| Molecular Formula | C6H4Cl2IN |
| Molecular Weight | 287.9131 |
| Density | 2.091g/cm3 |
| Boiling point | 303.8°C at 760 mmHg |
| Flash point | 137.5°C |
| Refractive index | 1.699 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
697-90-5 2,4-dichloro-6-iodoaniline
service@apichina.com