| Product Name | (2,4-Dichloro-5-methylphenylthio)acetic acid |
| CAS No. | 71735-21-2 |
| Synonyms | ((2,4-Dichloro-5-methylphenyl)thio)acetic acid; [(2,4-dichloro-5-methylphenyl)sulfanyl]acetic acid |
| InChI | InChI=1/C9H8Cl2O2S/c1-5-2-8(14-4-9(12)13)7(11)3-6(5)10/h2-3H,4H2,1H3,(H,12,13) |
| Molecular Formula | C9H8Cl2O2S |
| Molecular Weight | 251.1296 |
| Density | 1.47g/cm3 |
| Boiling point | 371.2°C at 760 mmHg |
| Flash point | 178.3°C |
| Refractive index | 1.623 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
71735-21-2 (2,4-dichloro-5-methylphenylthio)acetic acid
service@apichina.com