| Product Name | 2,4-Dichloro-5-isopropoxyaniline |
| CAS No. | 41200-96-8 |
| Synonyms | 2,4-dichloro-5-(propan-2-yloxy)aniline |
| InChI | InChI=1/C9H11Cl2NO/c1-5(2)13-9-4-8(12)6(10)3-7(9)11/h3-5H,12H2,1-2H3 |
| Molecular Formula | C9H11Cl2NO |
| Molecular Weight | 220.0957 |
| Density | 1.272g/cm3 |
| Boiling point | 310.8°C at 760 mmHg |
| Flash point | 141.8°C |
| Refractive index | 1.562 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
41200-96-8 2,4-dichloro-5-isopropoxyaniline
service@apichina.com