| Product Name | 2,4-Dichloro-3,5-dinitrobenzoic acid |
| CAS No. | 52729-03-0 |
| Synonyms | 2,4-dichloro-3,5-dinitrobenzoate |
| InChI | InChI=1/C7H2Cl2N2O6/c8-4-2(7(12)13)1-3(10(14)15)5(9)6(4)11(16)17/h1H,(H,12,13)/p-1 |
| Molecular Formula | C7HCl2N2O6 |
| Molecular Weight | 279.9992 |
| Melting point | 210-215℃ |
| Boiling point | 433.7°C at 760 mmHg |
| Flash point | 216.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
52729-03-0 2,4-dichloro-3,5-dinitrobenzoic acid
service@apichina.com