| Product Name | 2,4-dichloro-1-(2-iodophenoxy)benzene |
| CAS No. | 175136-78-4 |
| InChI | InChI=1/C12H7Cl2IO/c13-8-5-6-11(9(14)7-8)16-12-4-2-1-3-10(12)15/h1-7H |
| Molecular Formula | C12H7Cl2IO |
| Molecular Weight | 364.9939 |
| Density | 1.771g/cm3 |
| Boiling point | 345.1°C at 760 mmHg |
| Flash point | 162.5°C |
| Refractive index | 1.652 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175136-78-4 2,4-dichloro-1-(2-iodophenoxy)benzene
service@apichina.com