| Product Name | 2,4-dibromophenyl isocyanate |
| CAS No. | 55076-90-9 |
| Synonyms | 2,4-dibromo-1-isocyanatobenzene |
| InChI | InChI=1/C7H3Br2NO/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| Molecular Formula | C7H3Br2NO |
| Molecular Weight | 276.9128 |
| Density | 1.92g/cm3 |
| Melting point | 81-85℃ |
| Boiling point | 290.8°C at 760 mmHg |
| Flash point | 129.7°C |
| Refractive index | 1.632 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
55076-90-9 2,4-dibromophenyl isocyanate
service@apichina.com