| Product Name | 2,4-Diamino-s-triazine |
| CAS No. | 504-08-5 |
| Synonyms | Diaminotriazine; 1,3,5-triazine-2,4-diamine; 2,4-Diamino-1,3,5-Triazine |
| InChI | InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
| Molecular Formula | C3H5N5 |
| Molecular Weight | 111.1053 |
| Density | 1.508g/cm3 |
| Boiling point | 447.6°C at 760 mmHg |
| Flash point | 254.9°C |
| Refractive index | 1.716 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
504-08-5 2,4-diamino-s-triazine
service@apichina.com