| Product Name | 2,4-Diamino-5-fluoroquinazoline |
| CAS No. | 119584-70-2 |
| Synonyms | 5-Fluoroquinazoline-2,4-diamine |
| InChI | InChI=1/C8H7FN4/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,(H4,10,11,12,13) |
| Molecular Formula | C8H7FN4 |
| Molecular Weight | 178.1664 |
| Density | 1.5g/cm3 |
| Boiling point | 463.1°C at 760 mmHg |
| Flash point | 233.9°C |
| Refractive index | 1.757 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
119584-70-2 2,4-diamino-5-fluoroquinazoline
service@apichina.com