| Product Name | 2-(4-cyanobenzylidene)hydrazine-1-carbothioamide |
| CAS No. | 22043-24-9 |
| Synonyms | 2-(4-cyanobenzylidene)hydrazinecarbothioamide |
| InChI | InChI=1/C9H8N4S/c10-5-7-1-3-8(4-2-7)6-12-13-9(11)14/h1-4,6H,(H3,11,13,14) |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.2516 |
| Density | 1.27g/cm3 |
| Melting point | 243℃ |
| Boiling point | 391.2°C at 760 mmHg |
| Flash point | 190.4°C |
| Refractive index | 1.652 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
22043-24-9 2-(4-cyanobenzylidene)hydrazine-1-carbothioamide
service@apichina.com