| Product Name | 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile |
| CAS No. | 78940-73-5 |
| Synonyms | 2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzonitrile |
| InChI | InChI=1/C13H7ClN2O2S/c14-10-1-4-12(5-2-10)19-13-6-3-11(16(17)18)7-9(13)8-15/h1-7H |
| Molecular Formula | C13H7ClN2O2S |
| Molecular Weight | 290.7249 |
| Density | 1.47g/cm3 |
| Melting point | 167℃ |
| Boiling point | 452.8°C at 760 mmHg |
| Flash point | 227.6°C |
| Refractive index | 1.685 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
service@apichina.com