| Product Name | 2-(4-Chlorophenyl)ethyl isothiocyanate |
| CAS No. | 17608-10-5 |
| Synonyms | 2-(4-Chlorophenethyl) isothiocyanate; 1-chloro-4-(2-isothiocyanatoethyl)benzene |
| InChI | InChI=1/C9H8ClNS/c10-9-3-1-8(2-4-9)5-6-11-7-12/h1-4H,5-6H2 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.6845 |
| Density | 1.15g/cm3 |
| Boiling point | 311°C at 760 mmHg |
| Flash point | 141.9°C |
| Refractive index | 1.572 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
17608-10-5 2-(4-chlorophenyl)ethyl isothiocyanate
service@apichina.com