| Product Name | 2-(4-Chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| CAS No. | 175137-19-6 |
| Synonyms | 1-(4-Chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carbonyl chloride; 6-(4-fluorophenyl)pyrimidine-2,4-diamine |
| InChI | InChI=1/C10H9FN4/c11-7-3-1-6(2-4-7)8-5-9(12)15-10(13)14-8/h1-5H,(H4,12,13,14,15) |
| Molecular Formula | C10H9FN4 |
| Molecular Weight | 204.2037 |
| Density | 1.361g/cm3 |
| Melting point | 52-53℃ |
| Boiling point | 493.9°C at 760 mmHg |
| Flash point | 252.5°C |
| Refractive index | 1.662 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175137-19-6 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride
service@apichina.com