| Product Name | 2-(4-chlorophenyl)-1,3-thiazolane-4-carboxylic acid |
| CAS No. | 34491-29-7 |
| Synonyms | 2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChI | InChI=1/C10H10ClNO2S/c11-7-3-1-6(2-4-7)9-12-8(5-15-9)10(13)14/h1-4,8-9,12H,5H2,(H,13,14) |
| Molecular Formula | C10H10ClNO2S |
| Molecular Weight | 243.7099 |
| Density | 1.411g/cm3 |
| Melting point | 150℃ |
| Boiling point | 458.3°C at 760 mmHg |
| Flash point | 231°C |
| Refractive index | 1.622 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
34491-29-7 2-(4-chlorophenyl)-1,3-thiazolane-4-carboxylic acid
service@apichina.com