| Product Name | 2-(4-Chloro-2-methylphenoxy)propionic acid |
| CAS No. | 93-65-2 |
| Synonyms | 2-(4-Chloro-o-tolyloxy)propionic acid; MCPP; Mecoprop; (-)-2-(4-chloro-o-tolyloxy)propionic acid; (2S)-2-(4-chloro-2-methylphenoxy)propanoic acid |
| InChI | InChI=1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m0/s1 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.6455 |
| Density | 1.265g/cm3 |
| Boiling point | 331.9°C at 760 mmHg |
| Flash point | 154.5°C |
| Water solubility | 734 mg l-1 |
| Refractive index | 1.542 |
| Risk Codes | R22:Harmful if swallowed.; R38:Irritating to skin.; R41:Risks of serious damage to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
93-65-2 2-(4-chloro-2-methylphenoxy)propionic acid
service@apichina.com