| Product Name | 2,4,6-Trimethylphenylhydrazine hydrochloride |
| CAS No. | 76195-82-9 |
| Synonyms | Mesitylhydrazine hydrochloride; (2,4,6-trimethylphenyl)diazanium chloride |
| InChI | InChI=1/C9H14N2.ClH/c1-6-4-7(2)9(11-10)8(3)5-6;/h4-5,11H,10H2,1-3H3;1H |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.6818 |
| Boiling point | 226.9°C at 760 mmHg |
| Flash point | 103.6°C |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
76195-82-9 2,4,6-trimethylphenylhydrazine hydrochloride
service@apichina.com