| Product Name | 2,4,6-Trimethylphenyl isothiocyanate |
| CAS No. | 6095-82-5 |
| Synonyms | Mesityl isothiocyanate; 2-isothiocyanato-1,3,5-trimethylbenzene |
| InChI | InChI=1/C10H11NS/c1-7-4-8(2)10(11-6-12)9(3)5-7/h4-5H,1-3H3 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.266 |
| Density | 1g/cm3 |
| Boiling point | 286.3°C at 760 mmHg |
| Flash point | 130.1°C |
| Refractive index | 1.549 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
6095-82-5 2,4,6-trimethylphenyl isothiocyanate
service@apichina.com