| Product Name | 2,4,6-Trimethoxybenzeneboronic acid |
| CAS No. | 135159-25-0 |
| Synonyms | 2,4,6-Trimethoxyphenylboronic acid |
| InChI | InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
| Molecular Formula | C9H13BO5 |
| Molecular Weight | 212.0075 |
| Density | 1.21g/cm3 |
| Boiling point | 413.8°C at 760 mmHg |
| Flash point | 204.1°C |
| Refractive index | 1.513 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
135159-25-0 2,4,6-trimethoxybenzeneboronic acid
service@apichina.com