| Product Name | 2,4,6-trifluoropyrimidine |
| CAS No. | 696-82-2 |
| Synonyms | 2,4,6-Trifluoropyrimidine |
| InChI | InChI=1/C4HF3N2/c5-2-1-3(6)9-4(7)8-2/h1H |
| Molecular Formula | C4HF3N2 |
| Molecular Weight | 134.0593 |
| Density | 1.514g/cm3 |
| Boiling point | 195.6°C at 760 mmHg |
| Flash point | 72.1°C |
| Refractive index | 1.42 |
| Risk Codes | R34:Causes burns.; R37:Irritating to respiratory system.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
696-82-2 2,4,6-trifluoropyrimidine
service@apichina.com