| Product Name | 2,4,6-(trifluorophenyl)isothiocyanate |
| CAS No. | 206761-91-3 |
| Synonyms | 2,4,6-Trifluorophenyl isothiocyanate; 1,3,5-trifluoro-2-isothiocyanatobenzene |
| InChI | InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| Molecular Formula | C7H2F3NS |
| Molecular Weight | 189.1577 |
| Density | 1.36g/cm3 |
| Boiling point | 213.9°C at 760 mmHg |
| Flash point | 83.1°C |
| Refractive index | 1.52 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
service@apichina.com