| Sales Email | Service@apichina.com |
| CAS No. | 50528-80-8 |
| Product Name | 2,4,6-Trifluorophenyl isocyanate |
| Synonyms | 1,3,5-trifluoro-2-isocyanatobenzene |
| InChI | InChI=1/C7H2F3NO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| Molecular Formula | C7H2F3NO |
| Molecular Weight | 173.0921 |
| Density | 1.35g/cm3 |
| Boiling point | 166.4°C at 760 mmHg |
| Flash point | 52.2°C |
| Refractive index | 1.473 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
