| Product Name | 2,4,6-Trifluorobenzyl bromide |
| CAS No. | 151411-98-2 |
| Synonyms | alpha-Bromo-2,4,6-trifluorotoluene; 2-(bromomethyl)-1,3,5-trifluorobenzene |
| InChI | InChI=1/C7H4BrF3/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
| Molecular Formula | C7H4BrF3 |
| Molecular Weight | 225.0059 |
| Density | 1.71g/cm3 |
| Boiling point | 177.4°C at 760 mmHg |
| Flash point | 66.1°C |
| Refractive index | 1.502 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
151411-98-2 2,4,6-trifluorobenzyl bromide
service@apichina.com