| Product Name | 2,4,6-Trifluorobenzotrifluoride |
| CAS No. | 122030-04-0 |
| Synonyms | alpha,alpha,alpha,2,4,6-Hexafluorotoluene~1,3,5-Trifluoro-2-(trifluoromethyl)benzene; 1,3,5-trifluoro-2-(trifluoromethyl)benzene; (2,6-difluorophenyl)(4-methylphenyl)methanone |
| InChI | InChI=1/C14H10F2O/c1-9-5-7-10(8-6-9)14(17)13-11(15)3-2-4-12(13)16/h2-8H,1H3 |
| Molecular Formula | C14H10F2O |
| Molecular Weight | 232.2254 |
| Density | 1.208g/cm3 |
| Boiling point | 348.2°C at 760 mmHg |
| Flash point | 133.4°C |
| Refractive index | 1.545 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
122030-04-0 2,4,6-trifluorobenzotrifluoride
service@apichina.com