| Product Name | 2,4,6-Trifluorobenzeneboronic acid |
| CAS No. | 182482-25-3 |
| Synonyms | 2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
| InChI | InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
| Molecular Formula | C6H4BF3O2 |
| Molecular Weight | 175.901 |
| Density | 1.44g/cm3 |
| Melting point | 228-235℃ |
| Boiling point | 266°C at 760 mmHg |
| Flash point | 114.6°C |
| Refractive index | 1.465 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
182482-25-3 2,4,6-trifluorobenzeneboronic acid
service@apichina.com