| Product Name | 2,4,6-Trichloronitro Benzene |
| CAS No. | 18708-70-8 |
| Synonyms | 2-Nitro-1,3,5-trichlorobenzene; 2,4,6-Trichloronitrobenzene; 1,3,5-trichloro-2-nitrobenzene |
| InChI | InChI=1/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| Molecular Formula | C6H2Cl3NO2 |
| Molecular Weight | 226.4446 |
| Density | 1.651g/cm3 |
| Melting point | 70-72℃ |
| Boiling point | 303.2°C at 760 mmHg |
| Flash point | 137.2°C |
| Refractive index | 1.609 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
18708-70-8 2,4,6-trichloronitro benzene
service@apichina.com