| Product Name | 2,4,5-Trihydroxypyrimidine |
| CAS No. | 496-76-4 |
| Synonyms | Isobarbituric acid; 5-hydroxypyrimidine-2,4(1H,3H)-dione; dihydropyrimidine-2,4,5(3H)-trione |
| InChI | InChI=1/C4H4N2O3/c7-2-1-5-4(9)6-3(2)8/h1H2,(H2,5,6,8,9) |
| Molecular Formula | C4H4N2O3 |
| Molecular Weight | 128.0862 |
| Density | 1.455g/cm3 |
| Melting point | 300℃ |
| Refractive index | 1.492 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
496-76-4 2,4,5-trihydroxypyrimidine
service@apichina.com
- Next:496-77-5 butyroin
- Previous:496-74-2 toluene-3,4-dithiol