| Product Name | 2,4,5-Trichlorothiophenol |
| CAS No. | 3773-14-6 |
| Synonyms | 2,4,5-Trichlorobenzenethiol; Trichlorothiophenol; 2,4,5-trichlorobenzenethiolate |
| InChI | InChI=1/C6H3Cl3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/p-1 |
| Molecular Formula | C6H2Cl3S |
| Molecular Weight | 212.5046 |
| Melting point | 117-118℃ |
| Boiling point | 283.2°C at 760 mmHg |
| Flash point | 114.6°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3773-14-6 2,4,5-trichlorothiophenol
service@apichina.com