| Product Name | 2,4,5-Trichlorophenyl isothiocyanate |
| CAS No. | 23165-46-0 |
| Synonyms | 2,4,5-Trichloroisothiocyanatobenzene; 1,2,4-trichloro-5-isothiocyanatobenzene |
| InChI | InChI=1/C7H2Cl3NS/c8-4-1-6(10)7(11-3-12)2-5(4)9/h1-2H |
| Molecular Formula | C7H2Cl3NS |
| Molecular Weight | 238.5215 |
| Density | 1.5g/cm3 |
| Boiling point | 330.3°C at 760 mmHg |
| Flash point | 153.5°C |
| Refractive index | 1.633 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
23165-46-0 2,4,5-trichlorophenyl isothiocyanate
service@apichina.com