| Product Name | 2,4,5-trichlorophenyl isocyanate |
| CAS No. | 26328-35-8 |
| Synonyms | 1,2,4-trichloro-5-isocyanatobenzene |
| InChI | InChI=1/C7H2Cl3NO/c8-4-1-6(10)7(11-3-12)2-5(4)9/h1-2H |
| Molecular Formula | C7H2Cl3NO |
| Molecular Weight | 222.4559 |
| Density | 1.51g/cm3 |
| Melting point | 55-61℃ |
| Boiling point | 286.5°C at 760 mmHg |
| Flash point | 113.6°C |
| Refractive index | 1.597 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
26328-35-8 2,4,5-trichlorophenyl isocyanate
service@apichina.com