| Product Name | 2,4,5-Trichloroacetanilide |
| CAS No. | 23627-24-9 |
| Synonyms | Acetanilide, 2',4',5'-trichloro-; 2',4',5'-Trichloroacetanilide; 2,4,5-Trichlorophenylacetamide; 3-12-00-01409 (Beilstein Handbook Reference); BRN 2939702; N-(2,4,5-Trichlorophenyl)acetamide |
| InChI | InChI=1/C8H6Cl3NO/c1-4(13)12-8-3-6(10)5(9)2-7(8)11/h2-3H,1H3,(H,12,13) |
| Molecular Formula | C8H6Cl3NO |
| Molecular Weight | 238.4983 |
| Density | 1.505g/cm3 |
| Boiling point | 374°C at 760 mmHg |
| Flash point | 180°C |
| Refractive index | 1.614 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
23627-24-9 2,4,5-trichloroacetanilide
service@apichina.com