| Product Name | 2-(4,5-dichloro-1H-imidazol-1-yl)ethanethioamide |
| CAS No. | 175201-50-0 |
| Synonyms | (4,5-Dichloroimidazol-1-yl)thioacetamide |
| InChI | InChI=1/C5H5Cl2N3S/c6-4-5(7)10(2-9-4)1-3(8)11/h2H,1H2,(H2,8,11) |
| Molecular Formula | C5H5Cl2N3S |
| Molecular Weight | 210.0843 |
| Density | 1.69g/cm3 |
| Melting point | 204℃ |
| Boiling point | 422.5°C at 760 mmHg |
| Flash point | 209.3°C |
| Refractive index | 1.71 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175201-50-0 2-(4,5-dichloro-1h-imidazol-1-yl)ethanethioamide
service@apichina.com