| Product Name | 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
| CAS No. | 69625-13-4 |
| Synonyms | [4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
| InChI | InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
| Molecular Formula | C11H7N3O2S |
| Molecular Weight | 245.2572 |
| Density | 1.397g/cm3 |
| Melting point | 147℃ |
| Boiling point | 457.3°C at 760 mmHg |
| Flash point | 230.3°C |
| Refractive index | 1.641 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
service@apichina.com