| Product Name | 2-{4-[(4-methoxybenzyl)oxy]phenyl}acetonitrile |
| CAS No. | 175135-47-4 |
| Synonyms | {4-[(4-methoxybenzyl)oxy]phenyl}acetonitrile |
| InChI | InChI=1/C16H15NO2/c1-18-15-6-4-14(5-7-15)12-19-16-8-2-13(3-9-16)10-11-17/h2-9H,10,12H2,1H3 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.2958 |
| Density | 1.129g/cm3 |
| Melting point | 140℃ |
| Boiling point | 424.5°C at 760 mmHg |
| Flash point | 154.8°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175135-47-4 2-{4-[(4-methoxybenzyl)oxy]phenyl}acetonitrile
service@apichina.com