| Product Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile |
| CAS No. | 17969-48-1 |
| Synonyms | 2-[4-(4-Fluorophenyl)-1,3-thiazol-2-yl]acetonitrile; [4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetonitrile; [4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile |
| InChI | InChI=1/C11H7ClN2S/c12-9-3-1-8(2-4-9)10-7-15-11(14-10)5-6-13/h1-4,7H,5H2 |
| Molecular Formula | C11H7ClN2S |
| Molecular Weight | 234.7047 |
| Density | 1.336g/cm3 |
| Melting point | 132℃ |
| Boiling point | 404.2°C at 760 mmHg |
| Flash point | 198.3°C |
| Refractive index | 1.62 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
17969-48-1 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]acetonitrile
service@apichina.com