| Product Name | 2-{4-[(4-chlorobenzyl)oxy]phenyl}acetonitrile |
| CAS No. | 175135-36-1 |
| Synonyms | {4-[(4-chlorobenzyl)oxy]phenyl}acetonitrile |
| InChI | InChI=1/C15H12ClNO/c16-14-5-1-13(2-6-14)11-18-15-7-3-12(4-8-15)9-10-17/h1-8H,9,11H2 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.7149 |
| Density | 1.213g/cm3 |
| Melting point | 113℃ |
| Boiling point | 414.5°C at 760 mmHg |
| Flash point | 204.5°C |
| Refractive index | 1.591 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175135-36-1 2-{4-[(4-chlorobenzyl)oxy]phenyl}acetonitrile
service@apichina.com