| Product Name | 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile |
| CAS No. | 499771-17-4 |
| Synonyms | [4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile |
| InChI | InChI=1/C13H10N2O2S/c14-4-3-13-15-10(8-18-13)9-1-2-11-12(7-9)17-6-5-16-11/h1-2,7-8H,3,5-6H2 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.2957 |
| Density | 1.341g/cm3 |
| Melting point | 115℃ |
| Boiling point | 456.2°C at 760 mmHg |
| Flash point | 229.7°C |
| Refractive index | 1.619 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
499771-17-4 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile
service@apichina.com