| Sales Email | Service@apichina.com |
| CAS No. | 39067-29-3 |
| Product Name | 2-(3-pyridyl)-1,3-thiazole-4-carboxylic acid |
| Synonyms | 2-(pyridin-3-yl)thiazole-4-carboxylic acid; 2-(3-Pyridyl)thiazole-4-carboxylic acid; 2-(pyridin-3-yl)-1,3-thiazole-4-carboxylic acid |
| InChI | InChI=1/C9H6N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-5H,(H,12,13) |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.2211 |
| Density | 1.44g/cm3 |
| Melting point | 278℃ |
| Boiling point | 460.3°C at 760 mmHg |
| Flash point | 232.2°C |
| Refractive index | 1.651 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
