| Product Name | 2,3-O-Isopropylidene-1-O-methyl-D-ribosic acid |
| CAS No. | 54622-95-6 |
| Synonyms | Methyl 2,3-O-isopropylidene-beta-D-ribofuranosiduronic acid; methyl 2,3-O-(1-methylethylidene)-beta-D-ribofuranosiduronic acid |
| InChI | InChI=1/C9H14O6/c1-9(2)14-4-5(7(10)11)13-8(12-3)6(4)15-9/h4-6,8H,1-3H3,(H,10,11)/t4-,5+,6-,8-/m1/s1 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.2039 |
| Density | 1.341g/cm3 |
| Boiling point | 341.604°C at 760 mmHg |
| Flash point | 135.064°C |
| Refractive index | 1.504 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
54622-95-6 2,3-o-isopropylidene-1-o-methyl-d-ribosic acid
service@apichina.com