| Product Name | 2-(3-methylpyrrolidin-1-yl)ethyl cyclohex-2-en-1-yl(phenyl)acetate |
| CAS No. | 4953-26-8;5411-42-7 |
| InChI | InChI=1/C21H29NO2/c1-17-12-13-22(16-17)14-15-24-21(23)20(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2,4-6,8-10,17,19-20H,3,7,11-16H2,1H3 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.4605 |
| Density | 1.064g/cm3 |
| Boiling point | 441.2°C at 760 mmHg |
| Flash point | 137.3°C |
| Refractive index | 1.542 |
4953-26-8;5411-42-7 2-(3-methylpyrrolidin-1-yl)ethyl cyclohex-2-en-1-yl(phenyl)acetate
service@apichina.com