| Product Name | 2-[(3-methylbenzyl)oxy]ethanol |
| CAS No. | 34135-75-6 |
| InChI | InChI=1/C10H14O2/c1-9-3-2-4-10(7-9)8-12-6-5-11/h2-4,7,11H,5-6,8H2,1H3 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.217 |
| Density | 1.046g/cm3 |
| Boiling point | 273.3°C at 760 mmHg |
| Flash point | 114.9°C |
| Refractive index | 1.522 |
34135-75-6 2-[(3-methylbenzyl)oxy]ethanol
service@apichina.com