| Product Name | 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid |
| CAS No. | 41306-29-0 |
| Synonyms | [(2Z)-3-methyl-2-(methylimino)-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| InChI | InChI=1/C7H10N2O3S/c1-8-7-9(2)6(12)4(13-7)3-5(10)11/h4H,3H2,1-2H3,(H,10,11)/b8-7- |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.2309 |
| Density | 1.47g/cm3 |
| Melting point | 158℃ |
| Boiling point | 374.5°C at 760 mmHg |
| Flash point | 180.3°C |
| Refractive index | 1.639 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
41306-29-0 2-[3-methyl-2-(methylimino)-4-oxo-1,3-thiazolan-5-yl]acetic acid
service@apichina.com