| Product Name | 2,3-heptanedione |
| CAS No. | 96-04-8 |
| Synonyms | 2,3-Heptanedione; Acetyl pentanoyl; Acetyl valeryl; FEMA No. 2543; NSC 31668; UNII-DK55DDE86P; Valerylacetyl; heptane-2,3-dione |
| InChI | InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.926g/cm3 |
| Boiling point | 149.7°C at 760 mmHg |
| Flash point | 45°C |
| Refractive index | 1.413 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
96-04-8 2,3-heptanedione
service@apichina.com