| Product Name | 2,3-Dimethylsuccinic acid, mixture of DL and meso |
| CAS No. | 13545-04-5 |
| Synonyms | 2,3-Dimethylsuccinic acid; 2,3-Butanedicarboxylic acid; NSC 41215; Butanedioic acid, 2,3-dimethyl- (9CI); Succinic acid, 2,3-dimethyl- (8CI); 2,3-dimethylbutanedioic acid; (2R,3S)-2,3-dimethylbutanedioate; (2R,3R)-2,3-dimethylbutanedioate; (2S,3S)-2,3-dimethylbutanedioate |
| InChI | InChI=1/C6H10O4/c1-3(5(7)8)4(2)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2/t3-,4-/m0/s1 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.1264 |
| Melting point | 120-122℃ |
| Boiling point | 241.9°C at 760 mmHg |
| Flash point | 114.4°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
13545-04-5 2,3-dimethylsuccinic acid, mixture of dl and meso
service@apichina.com