| Product Name | 2,3-Dimethylphenylhydrazine hydrochloride |
| CAS No. | 123333-92-6;56737-75-8 |
| Synonyms | (2,3-dimethylphenyl)diazanium chloride; (2,3-dimethylphenyl)hydrazine; (2,3-dimethylphenyl)hydrazine hydrochloride hydrate |
| InChI | InChI=1/C8H12N2.ClH.H2O/c1-6-4-3-5-8(10-9)7(6)2;;/h3-5,10H,9H2,1-2H3;1H;1H2 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.6705 |
| Melting point | 210℃ |
| Boiling point | 355°C at 760 mmHg |
| Flash point | 168.5°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
123333-92-6;56737-75-8 2,3-dimethylphenylhydrazine hydrochloride
service@apichina.com