| Product Name | 2,3-Dimethylphenoxyacetic acid |
| CAS No. | 2935-63-9 |
| Synonyms | 2,3-Xylyloxyacetic acid; (2,3-dimethylphenoxy)acetate |
| InChI | InChI=1/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| Molecular Formula | C10H11O3 |
| Molecular Weight | 179.1931 |
| Boiling point | 315.2°C at 760 mmHg |
| Flash point | 124.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2935-63-9 2,3-dimethylphenoxyacetic acid
service@apichina.com