| Product Name | 2,3-Dimethylmaleic anhydride |
| CAS No. | 766-39-2 |
| Synonyms | 3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione; 4,5-Dimethyl-1,3-Dioxa-2-Oxo-Cyclopentene |
| InChI | InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 |
| Density | 1.236g/cm3 |
| Melting point | 93-96℃ |
| Boiling point | 223°C at 760 mmHg |
| Flash point | 95.6°C |
| Refractive index | 1.486 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
766-39-2 2,3-dimethylmaleic anhydride
service@apichina.com