| Product Name | 2,3-Dimethylbenzeneboronic acid |
| CAS No. | 183158-34-1 |
| Synonyms | 2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
| InChI | InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
| Molecular Formula | C8H11BO2 |
| Molecular Weight | 149.9827 |
| Density | 1.07g/cm3 |
| Melting point | 174-180℃ |
| Boiling point | 312.6°C at 760 mmHg |
| Flash point | 142.8°C |
| Refractive index | 1.523 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
183158-34-1 2,3-dimethylbenzeneboronic acid
service@apichina.com