| Product Name | 2,3-Dimethyl-p-phenylenediamine |
| CAS No. | 5306-96-7 |
| Synonyms | p-Phenylenediamine, 2,3-dimethyl-; 4-Amino-5,6-dimethylaniline; CCRIS 8132; 2,3-dimethylbenzene-1,4-diamine; 1,4-Diamino-2,3-dimethylbenzene |
| InChI | InChI=1/C8H12N2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,9-10H2,1-2H3 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.1943 |
| Density | 1.076g/cm3 |
| Boiling point | 288.5°C at 760 mmHg |
| Flash point | 151.5°C |
| Refractive index | 1.618 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
5306-96-7 2,3-dimethyl-p-phenylenediamine
service@apichina.com