| Product Name | 2,3-Dimethoxytoluene |
| CAS No. | 4463-33-6 |
| Synonyms | 3-Methylveratrole; 1,2-dimethoxy-3-methylbenzene |
| InChI | InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.1904 |
| Density | 0.99g/cm3 |
| Boiling point | 201.4°C at 760 mmHg |
| Flash point | 67.6°C |
| Refractive index | 1.489 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4463-33-6 2,3-dimethoxytoluene
service@apichina.com