| Product Name | 2,3-Dimethoxybenzonitrile |
| CAS No. | 5653-62-3 |
| Synonyms | Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
| InChI | InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.17 |
| Melting point | 41-46℃ |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
5653-62-3 2,3-dimethoxybenzonitrile
service@apichina.com