| Product Name | 2,3-Dimethoxybenzaldoxime |
| CAS No. | 5470-95-1 |
| Synonyms | o-Veratraldehyde, oxime; 2-08-00-00269 (Beilstein Handbook Reference); AI3-03770; BRN 1953084; Benzaldehyde, 2,3-dimethoxy-, oxime; 1-(2,3-dimethoxyphenyl)-N-hydroxymethanimine; 2,3-dimethoxybenzaldehyde oxime |
| InChI | InChI=1/C9H11NO3/c1-12-8-5-3-4-7(6-10-11)9(8)13-2/h3-6,11H,1-2H3/b10-6+ |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.1885 |
| Density | 1.11g/cm3 |
| Boiling point | 293.1°C at 760 mmHg |
| Flash point | 131.1°C |
| Refractive index | 1.501 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5470-95-1 2,3-dimethoxybenzaldoxime
service@apichina.com